C23H21N5O3 — CID 67013433
N-[2-[[4-(3-pyridin-2-ylprop-2-enoyl)phenyl]carbamoylamino]ethyl]pyridine-3-carboxamide (PubChem CID 67013433) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is N-[2-[[4-(3-pyridin-2-ylprop-2-enoyl)phenyl]carbamoylamino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[4-(3-pyridin-2-ylprop-2-enoyl)phenyl]carbamoylamino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67013433 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | N-[2-[[4-(3-pyridin-2-ylprop-2-enoyl)phenyl]carbamoylamino]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCNC(=O)c1cccnc1)Nc1ccc(C(=O)C=Cc2ccccn2)cc1 |
| InChI | InChI=1S/C23H21N5O3/c29-21(11-10-19-5-1-2-13-25-19)17-6-8-20(9-7-17)28-23(31)27-15-14-26-22(30)18-4-3-12-24-16-18/h1-13,16H,14-15H2,(H,26,30)(H2,27,28,31) |
| InChIKey | LZNSJBMSTQYEIF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|