C18H21N5O — CID 45053759
N-[(E)-1-(4-aminophenyl)ethylideneamino]-5-phenylpyrazolidine-3-carboxamide (PubChem CID 45053759) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[(E)-1-(4-aminophenyl)ethylideneamino]-5-phenylpyrazolidine-3-carboxamide.
| Compound Name | N-[(E)-1-(4-aminophenyl)ethylideneamino]-5-phenylpyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 45053759 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-[(E)-1-(4-aminophenyl)ethylideneamino]-5-phenylpyrazolidine-3-carboxamide |
| SMILES | C/C(=N\NC(=O)C1CC(c2ccccc2)NN1)c1ccc(N)cc1 |
| InChI | InChI=1S/C18H21N5O/c1-12(13-7-9-15(19)10-8-13)20-23-18(24)17-11-16(21-22-17)14-5-3-2-4-6-14/h2-10,16-17,21-22H,11,19H2,1H3,(H,23,24)/b20-12+ |
| InChIKey | SJJOJIMTZKHSBQ-UDWIEESQSA-N |
| XLogP | 1.72 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|