C22H28N4O3 — CID 156591339
N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]-5-(4-propoxyphenyl)pyrazolidine-3-carboxamide (PubChem CID 156591339) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]-5-(4-propoxyphenyl)pyrazolidine-3-carboxamide.
| Compound Name | N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]-5-(4-propoxyphenyl)pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 156591339 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]-5-(4-propoxyphenyl)pyrazolidine-3-carboxamide |
| SMILES | CCCOc1ccc(C2CC(C(=O)N/N=C(/C)c3ccc(OC)cc3)NN2)cc1 |
| InChI | InChI=1S/C22H28N4O3/c1-4-13-29-19-11-7-17(8-12-19)20-14-21(25-24-20)22(27)26-23-15(2)16-5-9-18(28-3)10-6-16/h5-12,20-21,24-25H,4,13-14H2,1-3H3,(H,26,27)/b23-15- |
| InChIKey | GHKCWSIGHAYGHK-HAHDFKILSA-N |
| XLogP | 2.93 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|