C16H22Cl2N2O — CID 45074849
3-methoxy-N-[phenyl(pyridin-4-yl)methyl]propan-1-amine;dihydrochloride (PubChem CID 45074849) has the molecular formula C16H22Cl2N2O and a molecular weight of 329.27 g/mol. Its IUPAC name is 3-methoxy-N-[phenyl(pyridin-4-yl)methyl]propan-1-amine;dihydrochloride.
| Compound Name | 3-methoxy-N-[phenyl(pyridin-4-yl)methyl]propan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 45074849 |
| Molecular Formula | C16H22Cl2N2O |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 3-methoxy-N-[phenyl(pyridin-4-yl)methyl]propan-1-amine;dihydrochloride |
| SMILES | COCCCNC(c1ccccc1)c1ccncc1.Cl.Cl |
| InChI | InChI=1S/C16H20N2O.2ClH/c1-19-13-5-10-18-16(14-6-3-2-4-7-14)15-8-11-17-12-9-15;;/h2-4,6-9,11-12,16,18H,5,10,13H2,1H3;2*1H |
| InChIKey | ZSYSLVZLWNANBV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|