C22H24F2N4O — CID 45076326
3-[2-(1H-benzimidazol-2-yl)ethyl]-1-cyclohexyl-1-(2,4-difluorophenyl)urea (PubChem CID 45076326) has the molecular formula C22H24F2N4O and a molecular weight of 398.46 g/mol. Its IUPAC name is 3-[2-(1H-benzimidazol-2-yl)ethyl]-1-cyclohexyl-1-(2,4-difluorophenyl)urea.
| Compound Name | 3-[2-(1H-benzimidazol-2-yl)ethyl]-1-cyclohexyl-1-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 45076326 |
| Molecular Formula | C22H24F2N4O |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 3-[2-(1H-benzimidazol-2-yl)ethyl]-1-cyclohexyl-1-(2,4-difluorophenyl)urea |
| SMILES | O=C(NCCc1nc2ccccc2[nH]1)N(c1ccc(F)cc1F)C1CCCCC1 |
| InChI | InChI=1S/C22H24F2N4O/c23-15-10-11-20(17(24)14-15)28(16-6-2-1-3-7-16)22(29)25-13-12-21-26-18-8-4-5-9-19(18)27-21/h4-5,8-11,14,16H,1-3,6-7,12-13H2,(H,25,29)(H,26,27) |
| InChIKey | WFSWTUGYZBWNKR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |