C19H28N4O2 — CID 99578317
3-[3-(1H-benzimidazol-2-yl)propyl]-1-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-1-methylurea (PubChem CID 99578317) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 3-[3-(1H-benzimidazol-2-yl)propyl]-1-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-1-methylurea.
| Compound Name | 3-[3-(1H-benzimidazol-2-yl)propyl]-1-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 99578317 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 3-[3-(1H-benzimidazol-2-yl)propyl]-1-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-1-methylurea |
| SMILES | CN(C[C@H]1CCCC[C@@H]1O)C(=O)NCCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H28N4O2/c1-23(13-14-7-2-5-10-17(14)24)19(25)20-12-6-11-18-21-15-8-3-4-9-16(15)22-18/h3-4,8-9,14,17,24H,2,5-7,10-13H2,1H3,(H,20,25)(H,21,22)/t14-,17+/m1/s1 |
| InChIKey | MWELZUYAPQSGSR-PBHICJAKSA-N |
| XLogP | 2.69 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|