C16H22N4O2 — CID 99577755
3-[3-(1H-benzimidazol-2-yl)propyl]-1-methyl-1-[(3S)-oxolan-3-yl]urea (PubChem CID 99577755) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-[3-(1H-benzimidazol-2-yl)propyl]-1-methyl-1-[(3S)-oxolan-3-yl]urea.
| Compound Name | 3-[3-(1H-benzimidazol-2-yl)propyl]-1-methyl-1-[(3S)-oxolan-3-yl]urea |
|---|---|
| PubChem CID | 99577755 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 3-[3-(1H-benzimidazol-2-yl)propyl]-1-methyl-1-[(3S)-oxolan-3-yl]urea |
| SMILES | CN(C(=O)NCCCc1nc2ccccc2[nH]1)[C@H]1CCOC1 |
| InChI | InChI=1S/C16H22N4O2/c1-20(12-8-10-22-11-12)16(21)17-9-4-7-15-18-13-5-2-3-6-14(13)19-15/h2-3,5-6,12H,4,7-11H2,1H3,(H,17,21)(H,18,19)/t12-/m0/s1 |
| InChIKey | RGQAKEWMDUYEJL-LBPRGKRZSA-N |
| XLogP | 1.93 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|