C19H20Cl2N4O — CID 30306692
3-[3-(1H-benzimidazol-2-yl)propyl]-1-[(3,4-dichlorophenyl)methyl]-1-methylurea (PubChem CID 30306692) has the molecular formula C19H20Cl2N4O and a molecular weight of 391.30 g/mol. Its IUPAC name is 3-[3-(1H-benzimidazol-2-yl)propyl]-1-[(3,4-dichlorophenyl)methyl]-1-methylurea.
| Compound Name | 3-[3-(1H-benzimidazol-2-yl)propyl]-1-[(3,4-dichlorophenyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 30306692 |
| Molecular Formula | C19H20Cl2N4O |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 3-[3-(1H-benzimidazol-2-yl)propyl]-1-[(3,4-dichlorophenyl)methyl]-1-methylurea |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)C(=O)NCCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H20Cl2N4O/c1-25(12-13-8-9-14(20)15(21)11-13)19(26)22-10-4-7-18-23-16-5-2-3-6-17(16)24-18/h2-3,5-6,8-9,11H,4,7,10,12H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | YTZYWFFEAICEME-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|