C17H14Cl3N3O2 — CID 112821054
N-[3-(1H-benzimidazol-2-yl)propyl]-2,3,5-trichloro-6-hydroxybenzamide (PubChem CID 112821054) has the molecular formula C17H14Cl3N3O2 and a molecular weight of 398.68 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)propyl]-2,3,5-trichloro-6-hydroxybenzamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)propyl]-2,3,5-trichloro-6-hydroxybenzamide |
|---|---|
| PubChem CID | 112821054 |
| Molecular Formula | C17H14Cl3N3O2 |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)propyl]-2,3,5-trichloro-6-hydroxybenzamide |
| SMILES | O=C(NCCCc1nc2ccccc2[nH]1)c1c(O)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C17H14Cl3N3O2/c18-9-8-10(19)16(24)14(15(9)20)17(25)21-7-3-6-13-22-11-4-1-2-5-12(11)23-13/h1-2,4-5,8,24H,3,6-7H2,(H,21,25)(H,22,23) |
| InChIKey | CPJPLPLQCBVBKC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|