C18H28N4O6 — CID 45076418
N-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(5-methyl-1,2-oxazol-3-yl)-N'-(oxolan-2-ylmethyl)butanediamide (PubChem CID 45076418) has the molecular formula C18H28N4O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(5-methyl-1,2-oxazol-3-yl)-N'-(oxolan-2-ylmethyl)butanediamide.
| Compound Name | N-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(5-methyl-1,2-oxazol-3-yl)-N'-(oxolan-2-ylmethyl)butanediamide |
|---|---|
| PubChem CID | 45076418 |
| Molecular Formula | C18H28N4O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(5-methyl-1,2-oxazol-3-yl)-N'-(oxolan-2-ylmethyl)butanediamide |
| SMILES | COCCNC(=O)CNC(=O)CCC(=O)N(CC1CCCO1)c1cc(C)on1 |
| InChI | InChI=1S/C18H28N4O6/c1-13-10-15(21-28-13)22(12-14-4-3-8-27-14)18(25)6-5-16(23)20-11-17(24)19-7-9-26-2/h10,14H,3-9,11-12H2,1-2H3,(H,19,24)(H,20,23) |
| InChIKey | KPWGCXQZYBMJBM-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|