C10H10N2O2S — CID 45076989
4-hydroxy-N,N-dimethyl-1,3-benzothiazole-2-carboxamide (PubChem CID 45076989) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is 4-hydroxy-N,N-dimethyl-1,3-benzothiazole-2-carboxamide.
| Compound Name | 4-hydroxy-N,N-dimethyl-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 45076989 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 4-hydroxy-N,N-dimethyl-1,3-benzothiazole-2-carboxamide |
| SMILES | CN(C)C(=O)c1nc2c(O)cccc2s1 |
| InChI | InChI=1S/C10H10N2O2S/c1-12(2)10(14)9-11-8-6(13)4-3-5-7(8)15-9/h3-5,13H,1-2H3 |
| InChIKey | BEMSTSHYJFPKMD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |