C16H13NO2S — CID 142245945
4-(2-phenylethyl)-1,3-benzothiazole-2-carboxylic acid (PubChem CID 142245945) has the molecular formula C16H13NO2S and a molecular weight of 283.35 g/mol. Its IUPAC name is 4-(2-phenylethyl)-1,3-benzothiazole-2-carboxylic acid.
| Compound Name | 4-(2-phenylethyl)-1,3-benzothiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 142245945 |
| Molecular Formula | C16H13NO2S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 4-(2-phenylethyl)-1,3-benzothiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc2c(CCc3ccccc3)cccc2s1 |
| InChI | InChI=1S/C16H13NO2S/c18-16(19)15-17-14-12(7-4-8-13(14)20-15)10-9-11-5-2-1-3-6-11/h1-8H,9-10H2,(H,18,19) |
| InChIKey | FDAVRTAJDMAKSO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |