C9H10N2O — CID 45077894
1-hydroxy-2,6-dimethylbenzimidazole (PubChem CID 45077894) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 1-hydroxy-2,6-dimethylbenzimidazole.
| Compound Name | 1-hydroxy-2,6-dimethylbenzimidazole |
|---|---|
| PubChem CID | 45077894 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 1-hydroxy-2,6-dimethylbenzimidazole |
| SMILES | Cc1ccc2nc(C)n(O)c2c1 |
| InChI | InChI=1S/C9H10N2O/c1-6-3-4-8-9(5-6)11(12)7(2)10-8/h3-5,12H,1-2H3 |
| InChIKey | VEVRNZLPBXGTNG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|