C13H16N2O2 — CID 83857993
2-(1,6-dimethylbenzimidazol-2-yl)-2-methylpropanoic acid (PubChem CID 83857993) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-(1,6-dimethylbenzimidazol-2-yl)-2-methylpropanoic acid.
| Compound Name | 2-(1,6-dimethylbenzimidazol-2-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 83857993 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-(1,6-dimethylbenzimidazol-2-yl)-2-methylpropanoic acid |
| SMILES | Cc1ccc2nc(C(C)(C)C(=O)O)n(C)c2c1 |
| InChI | InChI=1S/C13H16N2O2/c1-8-5-6-9-10(7-8)15(4)11(14-9)13(2,3)12(16)17/h5-7H,1-4H3,(H,16,17) |
| InChIKey | ASXDXNVDIOQSTP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |