C9H6O — CID 45079125
2-(2-ethynylcyclopenta-2,4-dien-1-ylidene)ethenol (PubChem CID 45079125) has the molecular formula C9H6O and a molecular weight of 130.15 g/mol. Its IUPAC name is 2-(2-ethynylcyclopenta-2,4-dien-1-ylidene)ethenol.
| Compound Name | 2-(2-ethynylcyclopenta-2,4-dien-1-ylidene)ethenol |
|---|---|
| PubChem CID | 45079125 |
| Molecular Formula | C9H6O |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.04 |
| IUPAC Name | 2-(2-ethynylcyclopenta-2,4-dien-1-ylidene)ethenol |
| SMILES | C#CC1=CC=CC1=C=CO |
| InChI | InChI=1S/C9H6O/c1-2-8-4-3-5-9(8)6-7-10/h1,3-5,7,10H |
| InChIKey | NRJDOSCXHBMCIK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|