C10H11FO — CID 170789294
(5Z)-7-(fluoromethyl)-4-methylideneocta-5,7-dien-2-yn-1-ol (PubChem CID 170789294) has the molecular formula C10H11FO and a molecular weight of 166.19 g/mol. Its IUPAC name is (5Z)-7-(fluoromethyl)-4-methylideneocta-5,7-dien-2-yn-1-ol.
| Compound Name | (5Z)-7-(fluoromethyl)-4-methylideneocta-5,7-dien-2-yn-1-ol |
|---|---|
| PubChem CID | 170789294 |
| Molecular Formula | C10H11FO |
| Molecular Weight | 166.19 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | (5Z)-7-(fluoromethyl)-4-methylideneocta-5,7-dien-2-yn-1-ol |
| SMILES | C=C(C#CCO)/C=C\C(=C)CF |
| InChI | InChI=1S/C10H11FO/c1-9(4-3-7-12)5-6-10(2)8-11/h5-6,12H,1-2,7-8H2/b6-5- |
| InChIKey | GDHUWGJOCCJKCT-WAYWQWQTSA-N |
| XLogP | 1.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.19 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|