C10H11FO — CID 123696469
4-(4-fluorocyclohexa-1,5-dien-1-yl)but-3-yn-1-ol (PubChem CID 123696469) has the molecular formula C10H11FO and a molecular weight of 166.19 g/mol. Its IUPAC name is 4-(4-fluorocyclohexa-1,5-dien-1-yl)but-3-yn-1-ol.
| Compound Name | 4-(4-fluorocyclohexa-1,5-dien-1-yl)but-3-yn-1-ol |
|---|---|
| PubChem CID | 123696469 |
| Molecular Formula | C10H11FO |
| Molecular Weight | 166.19 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 4-(4-fluorocyclohexa-1,5-dien-1-yl)but-3-yn-1-ol |
| SMILES | OCCC#CC1=CCC(F)C=C1 |
| InChI | InChI=1S/C10H11FO/c11-10-6-4-9(5-7-10)3-1-2-8-12/h4-6,10,12H,2,7-8H2 |
| InChIKey | FCKYLKFGCICZQI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|