C15H15N3O — CID 45086915
N-(5-amino-2,3-dihydro-1H-inden-2-yl)pyridine-2-carboxamide (PubChem CID 45086915) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is N-(5-amino-2,3-dihydro-1H-inden-2-yl)pyridine-2-carboxamide.
| Compound Name | N-(5-amino-2,3-dihydro-1H-inden-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 45086915 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | N-(5-amino-2,3-dihydro-1H-inden-2-yl)pyridine-2-carboxamide |
| SMILES | Nc1ccc2c(c1)CC(NC(=O)c1ccccn1)C2 |
| InChI | InChI=1S/C15H15N3O/c16-12-5-4-10-8-13(9-11(10)7-12)18-15(19)14-3-1-2-6-17-14/h1-7,13H,8-9,16H2,(H,18,19) |
| InChIKey | BTLJIOIBHKEPQS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|