C15H17N3 — CID 11310989
2-N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-2,5-diamine (PubChem CID 11310989) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-2,5-diamine.
| Compound Name | 2-N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-2,5-diamine |
|---|---|
| PubChem CID | 11310989 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-2,5-diamine |
| SMILES | Nc1ccc2c(c1)CC(NCc1ccccn1)C2 |
| InChI | InChI=1S/C15H17N3/c16-13-5-4-11-8-15(9-12(11)7-13)18-10-14-3-1-2-6-17-14/h1-7,15,18H,8-10,16H2 |
| InChIKey | DPVZUVOGZKAARG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|