C26H35IN6 — CID 159564484
iodoethane;1-N,3-N,5-N-tris(pyridin-2-ylmethyl)cyclohexane-1,3,5-triamine (PubChem CID 159564484) has the molecular formula C26H35IN6 and a molecular weight of 558.51 g/mol. Its IUPAC name is iodoethane;1-N,3-N,5-N-tris(pyridin-2-ylmethyl)cyclohexane-1,3,5-triamine.
| Compound Name | iodoethane;1-N,3-N,5-N-tris(pyridin-2-ylmethyl)cyclohexane-1,3,5-triamine |
|---|---|
| PubChem CID | 159564484 |
| Molecular Formula | C26H35IN6 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | iodoethane;1-N,3-N,5-N-tris(pyridin-2-ylmethyl)cyclohexane-1,3,5-triamine |
| SMILES | CCI.c1ccc(CNC2CC(NCc3ccccn3)CC(NCc3ccccn3)C2)nc1 |
| InChI | InChI=1S/C24H30N6.C2H5I/c1-4-10-25-19(7-1)16-28-22-13-23(29-17-20-8-2-5-11-26-20)15-24(14-22)30-18-21-9-3-6-12-27-21;1-2-3/h1-12,22-24,28-30H,13-18H2;2H2,1H3 |
| InChIKey | MHAJIBXQDGQWQY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|