C7H15N3O — CID 45088514
N,N'-dimethyl-N-morpholin-4-ylmethanimidamide (PubChem CID 45088514) has the molecular formula C7H15N3O and a molecular weight of 157.22 g/mol. Its IUPAC name is N,N'-dimethyl-N-morpholin-4-ylmethanimidamide.
| Compound Name | N,N'-dimethyl-N-morpholin-4-ylmethanimidamide |
|---|---|
| PubChem CID | 45088514 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | N,N'-dimethyl-N-morpholin-4-ylmethanimidamide |
| SMILES | C/N=C/N(C)N1CCOCC1 |
| InChI | InChI=1S/C7H15N3O/c1-8-7-9(2)10-3-5-11-6-4-10/h7H,3-6H2,1-2H3/b8-7+ |
| InChIKey | GHTWIIDSESMMHJ-BQYQJAHWSA-N |
| XLogP | -0.18 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|