About methyl 5-amino-3-methylsulfanyl-1,2-oxazole-4-carboxylate
methyl 5-amino-3-methylsulfanyl-1,2-oxazole-4-carboxylate (PubChem CID 45089184) has the molecular formula C6H8N2O3S
and a molecular weight of 188.21 g/mol. Its IUPAC name is methyl 5-amino-3-methylsulfanyl-1,2-oxazole-4-carboxylate.
Analyze methyl 5-amino-3-methylsulfanyl-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-amino-3-methylsulfanyl-1,2-oxazole-4-carboxylate?
The IUPAC name of methyl 5-amino-3-methylsulfanyl-1,2-oxazole-4-carboxylate (CID 45089184) is methyl 5-amino-3-methylsulfanyl-1,2-oxazole-4-carboxylate.
What is the SMILES notation for methyl 5-amino-3-methylsulfanyl-1,2-oxazole-4-carboxylate?
The canonical SMILES for methyl 5-amino-3-methylsulfanyl-1,2-oxazole-4-carboxylate is COC(=O)c1c(SC)noc1N.
What is the InChIKey of methyl 5-amino-3-methylsulfanyl-1,2-oxazole-4-carboxylate?
The InChIKey is AYNCAFOSIUQUKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3S/c1-10-6(9)3-4(7)11-8-5(3)12-2/h7H2,1-2H3.
What are the key properties of methyl 5-amino-3-methylsulfanyl-1,2-oxazole-4-carboxylate?
methyl 5-amino-3-methylsulfanyl-1,2-oxazole-4-carboxylate has a molecular weight of 188.21 g/mol, XLogP of 0.77, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-amino-3-methylsulfanyl-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 45089184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).