C10H21NO3 — CID 45092001
tert-butyl-[(2R)-1-hydroxy-2-methylbutan-2-yl]carbamic acid (PubChem CID 45092001) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is tert-butyl-[(2R)-1-hydroxy-2-methylbutan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[(2R)-1-hydroxy-2-methylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 45092001 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | tert-butyl-[(2R)-1-hydroxy-2-methylbutan-2-yl]carbamic acid |
| SMILES | CC[C@](C)(CO)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C10H21NO3/c1-6-10(5,7-12)11(8(13)14)9(2,3)4/h12H,6-7H2,1-5H3,(H,13,14)/t10-/m1/s1 |
| InChIKey | YYSUYSVRPKHVKI-SNVBAGLBSA-N |
| XLogP | 1.93 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |