C10H21NO3 — CID 89123802
tert-butyl-(1-methoxy-2-methylpropan-2-yl)carbamic acid (PubChem CID 89123802) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is tert-butyl-(1-methoxy-2-methylpropan-2-yl)carbamic acid.
| Compound Name | tert-butyl-(1-methoxy-2-methylpropan-2-yl)carbamic acid |
|---|---|
| PubChem CID | 89123802 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | tert-butyl-(1-methoxy-2-methylpropan-2-yl)carbamic acid |
| SMILES | COCC(C)(C)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C10H21NO3/c1-9(2,3)11(8(12)13)10(4,5)7-14-6/h7H2,1-6H3,(H,12,13) |
| InChIKey | QRJNVZFIKRRXBM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |