C9H17FO2 — CID 45098183
4-(fluoromethyl)-1,1-dimethoxycyclohexane (PubChem CID 45098183) has the molecular formula C9H17FO2 and a molecular weight of 176.23 g/mol. Its IUPAC name is 4-(fluoromethyl)-1,1-dimethoxycyclohexane.
| Compound Name | 4-(fluoromethyl)-1,1-dimethoxycyclohexane |
|---|---|
| PubChem CID | 45098183 |
| Molecular Formula | C9H17FO2 |
| Molecular Weight | 176.23 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 4-(fluoromethyl)-1,1-dimethoxycyclohexane |
| SMILES | COC1(OC)CCC(CF)CC1 |
| InChI | InChI=1S/C9H17FO2/c1-11-9(12-2)5-3-8(7-10)4-6-9/h8H,3-7H2,1-2H3 |
| InChIKey | PIAMPAYVWAISQU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|