C12H18O2 — CID 45098758
(1R,4E,5S)-4-ethylidene-1,8,8-trimethyl-2-oxabicyclo[3.2.1]octan-3-one (PubChem CID 45098758) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (1R,4E,5S)-4-ethylidene-1,8,8-trimethyl-2-oxabicyclo[3.2.1]octan-3-one.
| Compound Name | (1R,4E,5S)-4-ethylidene-1,8,8-trimethyl-2-oxabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 45098758 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (1R,4E,5S)-4-ethylidene-1,8,8-trimethyl-2-oxabicyclo[3.2.1]octan-3-one |
| SMILES | C/C=C1/C(=O)O[C@]2(C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C12H18O2/c1-5-8-9-6-7-12(4,11(9,2)3)14-10(8)13/h5,9H,6-7H2,1-4H3/b8-5+/t9-,12-/m1/s1 |
| InChIKey | OLRUQJLTFXSSQO-GAVOXZQTSA-N |
| XLogP | 2.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|