C8H11NO2 — CID 45099055
3-(1-ethylcyclopropyl)-4H-1,2-oxazol-5-one (PubChem CID 45099055) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 3-(1-ethylcyclopropyl)-4H-1,2-oxazol-5-one.
| Compound Name | 3-(1-ethylcyclopropyl)-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 45099055 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 3-(1-ethylcyclopropyl)-4H-1,2-oxazol-5-one |
| SMILES | CCC1(C2=NOC(=O)C2)CC1 |
| InChI | InChI=1S/C8H11NO2/c1-2-8(3-4-8)6-5-7(10)11-9-6/h2-5H2,1H3 |
| InChIKey | ANHXKRMLNWOOBN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|