C6H10N2O3 — CID 45099481
4-(2-hydroxyethyl)piperazine-2,6-dione (PubChem CID 45099481) has the molecular formula C6H10N2O3 and a molecular weight of 158.16 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)piperazine-2,6-dione.
| Compound Name | 4-(2-hydroxyethyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 45099481 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 4-(2-hydroxyethyl)piperazine-2,6-dione |
| SMILES | O=C1CN(CCO)CC(=O)N1 |
| InChI | InChI=1S/C6H10N2O3/c9-2-1-8-3-5(10)7-6(11)4-8/h9H,1-4H2,(H,7,10,11) |
| InChIKey | XFGLZOQWQOHWTL-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|