C23H34O6 — CID 45100925
[(1S,2R,5S,7R,8R,9R,11R,15S,18R)-7,15-dihydroxy-16-methoxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] acetate (PubChem CID 45100925) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is [(1S,2R,5S,7R,8R,9R,11R,15S,18R)-7,15-dihydroxy-16-methoxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] acetate.
| Compound Name | [(1S,2R,5S,7R,8R,9R,11R,15S,18R)-7,15-dihydroxy-16-methoxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] acetate |
|---|---|
| PubChem CID | 45100925 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | [(1S,2R,5S,7R,8R,9R,11R,15S,18R)-7,15-dihydroxy-16-methoxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] acetate |
| SMILES | C=C1[C@@H](O)[C@]23[C@H](OC(C)=O)[C@H]1CC[C@H]2[C@@]12C(OC)O[C@@H]3C[C@@H]1C(C)(C)CC[C@@H]2O |
| InChI | InChI=1S/C23H34O6/c1-11-13-6-7-14-22-15(21(3,4)9-8-16(22)25)10-17(29-20(22)27-5)23(14,18(11)26)19(13)28-12(2)24/h13-20,25-26H,1,6-10H2,2-5H3/t13-,14-,15+,16-,17+,18+,19+,20?,22+,23-/m0/s1 |
| InChIKey | KAKXHEGQPGREER-NKSLUNOTSA-N |
| XLogP | 2.42 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|