C28H38O10 — CID 4238832
(3,16,18-triacetyloxy-6,12,12-trimethyl-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-15-yl) acetate (PubChem CID 4238832) has the molecular formula C28H38O10 and a molecular weight of 534.60 g/mol. Its IUPAC name is (3,16,18-triacetyloxy-6,12,12-trimethyl-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-15-yl) acetate.
| Compound Name | (3,16,18-triacetyloxy-6,12,12-trimethyl-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-15-yl) acetate |
|---|---|
| PubChem CID | 4238832 |
| Molecular Formula | C28H38O10 |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | (3,16,18-triacetyloxy-6,12,12-trimethyl-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-15-yl) acetate |
| SMILES | CC(=O)OC1CC2C(C)C(=O)C3(C4CC5C(C)(C)CCC(OC(C)=O)C5(C(OC(C)=O)O4)C13)C2OC(C)=O |
| InChI | InChI=1S/C28H38O10/c1-12-17-10-18(34-13(2)29)22-27-19(26(6,7)9-8-20(27)35-14(3)30)11-21(38-25(27)37-16(5)32)28(22,23(12)33)24(17)36-15(4)31/h12,17-22,24-25H,8-11H2,1-7H3 |
| InChIKey | SIUUVHCUNLXSAT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|