C13H6F5NO3 — CID 45103211
(2-nitrophenyl)-(2,3,4,5,6-pentafluorophenyl)methanol (PubChem CID 45103211) has the molecular formula C13H6F5NO3 and a molecular weight of 319.19 g/mol. Its IUPAC name is (2-nitrophenyl)-(2,3,4,5,6-pentafluorophenyl)methanol.
| Compound Name | (2-nitrophenyl)-(2,3,4,5,6-pentafluorophenyl)methanol |
|---|---|
| PubChem CID | 45103211 |
| Molecular Formula | C13H6F5NO3 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | (2-nitrophenyl)-(2,3,4,5,6-pentafluorophenyl)methanol |
| SMILES | O=[N+]([O-])c1ccccc1C(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H6F5NO3/c14-8-7(9(15)11(17)12(18)10(8)16)13(20)5-3-1-2-4-6(5)19(21)22/h1-4,13,20H |
| InChIKey | MRONFLMYEJZBFY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|