C15H31NO2Si — CID 45103244
tert-butyl-dimethyl-[2-[5-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-3-yl]ethoxy]silane (PubChem CID 45103244) has the molecular formula C15H31NO2Si and a molecular weight of 285.50 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-[5-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-3-yl]ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-[5-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-3-yl]ethoxy]silane |
|---|---|
| PubChem CID | 45103244 |
| Molecular Formula | C15H31NO2Si |
| Molecular Weight | 285.50 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | tert-butyl-dimethyl-[2-[5-(2-methylpropyl)-4,5-dihydro-1,2-oxazol-3-yl]ethoxy]silane |
| SMILES | CC(C)CC1CC(CCO[Si](C)(C)C(C)(C)C)=NO1 |
| InChI | InChI=1S/C15H31NO2Si/c1-12(2)10-14-11-13(16-18-14)8-9-17-19(6,7)15(3,4)5/h12,14H,8-11H2,1-7H3 |
| InChIKey | PAQQQQKURHHCKD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|