C16H24BrNO2Si — CID 59749522
[(5R)-3-(4-bromophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 59749522) has the molecular formula C16H24BrNO2Si and a molecular weight of 370.36 g/mol. Its IUPAC name is [(5R)-3-(4-bromophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(5R)-3-(4-bromophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 59749522 |
| Molecular Formula | C16H24BrNO2Si |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | [(5R)-3-(4-bromophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CC(c2ccc(Br)cc2)=NO1 |
| InChI | InChI=1S/C16H24BrNO2Si/c1-16(2,3)21(4,5)19-11-14-10-15(18-20-14)12-6-8-13(17)9-7-12/h6-9,14H,10-11H2,1-5H3/t14-/m1/s1 |
| InChIKey | GCMBEAKNNVXFAY-CQSZACIVSA-N |
| XLogP | 4.96 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|