C11H16BrNO2 — CID 45103412
(3aS,7S,7aS)-7-bromo-3-tert-butyl-3a,6,7,7a-tetrahydro-1,3-benzoxazol-2-one (PubChem CID 45103412) has the molecular formula C11H16BrNO2 and a molecular weight of 274.16 g/mol. Its IUPAC name is (3aS,7S,7aS)-7-bromo-3-tert-butyl-3a,6,7,7a-tetrahydro-1,3-benzoxazol-2-one.
| Compound Name | (3aS,7S,7aS)-7-bromo-3-tert-butyl-3a,6,7,7a-tetrahydro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 45103412 |
| Molecular Formula | C11H16BrNO2 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | (3aS,7S,7aS)-7-bromo-3-tert-butyl-3a,6,7,7a-tetrahydro-1,3-benzoxazol-2-one |
| SMILES | CC(C)(C)N1C(=O)O[C@@H]2[C@@H](Br)CC=C[C@@H]21 |
| InChI | InChI=1S/C11H16BrNO2/c1-11(2,3)13-8-6-4-5-7(12)9(8)15-10(13)14/h4,6-9H,5H2,1-3H3/t7-,8-,9+/m0/s1 |
| InChIKey | SPJCNZFEADCGTE-XHNCKOQMSA-N |
| XLogP | 2.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|