C11H17NO2 — CID 11298510
(3aR,7aS)-3-butyl-3a,4,7,7a-tetrahydro-1,3-benzoxazol-2-one (PubChem CID 11298510) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (3aR,7aS)-3-butyl-3a,4,7,7a-tetrahydro-1,3-benzoxazol-2-one.
| Compound Name | (3aR,7aS)-3-butyl-3a,4,7,7a-tetrahydro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 11298510 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (3aR,7aS)-3-butyl-3a,4,7,7a-tetrahydro-1,3-benzoxazol-2-one |
| SMILES | CCCCN1C(=O)O[C@H]2CC=CC[C@H]21 |
| InChI | InChI=1S/C11H17NO2/c1-2-3-8-12-9-6-4-5-7-10(9)14-11(12)13/h4-5,9-10H,2-3,6-8H2,1H3/t9-,10+/m1/s1 |
| InChIKey | UZCFCYCPFBIYLB-ZJUUUORDSA-N |
| XLogP | 2.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|