C16H20N2O4 — CID 45104634
3-(4-ethylpiperazin-1-yl)-5,7-dihydroxy-4-methylchromen-2-one (PubChem CID 45104634) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 3-(4-ethylpiperazin-1-yl)-5,7-dihydroxy-4-methylchromen-2-one.
| Compound Name | 3-(4-ethylpiperazin-1-yl)-5,7-dihydroxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 45104634 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-(4-ethylpiperazin-1-yl)-5,7-dihydroxy-4-methylchromen-2-one |
| SMILES | CCN1CCN(c2c(C)c3c(O)cc(O)cc3oc2=O)CC1 |
| InChI | InChI=1S/C16H20N2O4/c1-3-17-4-6-18(7-5-17)15-10(2)14-12(20)8-11(19)9-13(14)22-16(15)21/h8-9,19-20H,3-7H2,1-2H3 |
| InChIKey | JTARAHFTVCXABJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|