C17H22N2O4 — CID 45104845
5,7-dimethoxy-4-methyl-3-(4-methylpiperazin-1-yl)chromen-2-one (PubChem CID 45104845) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 5,7-dimethoxy-4-methyl-3-(4-methylpiperazin-1-yl)chromen-2-one.
| Compound Name | 5,7-dimethoxy-4-methyl-3-(4-methylpiperazin-1-yl)chromen-2-one |
|---|---|
| PubChem CID | 45104845 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 5,7-dimethoxy-4-methyl-3-(4-methylpiperazin-1-yl)chromen-2-one |
| SMILES | COc1cc(OC)c2c(C)c(N3CCN(C)CC3)c(=O)oc2c1 |
| InChI | InChI=1S/C17H22N2O4/c1-11-15-13(22-4)9-12(21-3)10-14(15)23-17(20)16(11)19-7-5-18(2)6-8-19/h9-10H,5-8H2,1-4H3 |
| InChIKey | FTBBXYKBHDWXDK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|