C22H31N3O — CID 45106816
4-benzyl-1-cyclohexyl-2-(4-methylpiperidin-1-yl)-4H-imidazol-5-one (PubChem CID 45106816) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is 4-benzyl-1-cyclohexyl-2-(4-methylpiperidin-1-yl)-4H-imidazol-5-one.
| Compound Name | 4-benzyl-1-cyclohexyl-2-(4-methylpiperidin-1-yl)-4H-imidazol-5-one |
|---|---|
| PubChem CID | 45106816 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 4-benzyl-1-cyclohexyl-2-(4-methylpiperidin-1-yl)-4H-imidazol-5-one |
| SMILES | CC1CCN(C2=NC(Cc3ccccc3)C(=O)N2C2CCCCC2)CC1 |
| InChI | InChI=1S/C22H31N3O/c1-17-12-14-24(15-13-17)22-23-20(16-18-8-4-2-5-9-18)21(26)25(22)19-10-6-3-7-11-19/h2,4-5,8-9,17,19-20H,3,6-7,10-16H2,1H3 |
| InChIKey | RASDGPXKZLDUPI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |