C16H27N3O — CID 45106854
3-(3,5-dimethylpyrazol-1-yl)-N-(4-methylcyclohexyl)butanamide (PubChem CID 45106854) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 3-(3,5-dimethylpyrazol-1-yl)-N-(4-methylcyclohexyl)butanamide.
| Compound Name | 3-(3,5-dimethylpyrazol-1-yl)-N-(4-methylcyclohexyl)butanamide |
|---|---|
| PubChem CID | 45106854 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 3-(3,5-dimethylpyrazol-1-yl)-N-(4-methylcyclohexyl)butanamide |
| SMILES | Cc1cc(C)n(C(C)CC(=O)NC2CCC(C)CC2)n1 |
| InChI | InChI=1S/C16H27N3O/c1-11-5-7-15(8-6-11)17-16(20)10-14(4)19-13(3)9-12(2)18-19/h9,11,14-15H,5-8,10H2,1-4H3,(H,17,20) |
| InChIKey | HKBVSMSMSCLDJN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |