C18H19N5O5 — CID 45106982
2-(3-hydroxy-4-methoxyphenyl)-8-oxo-9-(oxolan-2-ylmethyl)-7H-purine-6-carboxamide (PubChem CID 45106982) has the molecular formula C18H19N5O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is 2-(3-hydroxy-4-methoxyphenyl)-8-oxo-9-(oxolan-2-ylmethyl)-7H-purine-6-carboxamide.
| Compound Name | 2-(3-hydroxy-4-methoxyphenyl)-8-oxo-9-(oxolan-2-ylmethyl)-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 45106982 |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-(3-hydroxy-4-methoxyphenyl)-8-oxo-9-(oxolan-2-ylmethyl)-7H-purine-6-carboxamide |
| SMILES | COc1ccc(-c2nc(C(N)=O)c3[nH]c(=O)n(CC4CCCO4)c3n2)cc1O |
| InChI | InChI=1S/C18H19N5O5/c1-27-12-5-4-9(7-11(12)24)16-20-13(15(19)25)14-17(22-16)23(18(26)21-14)8-10-3-2-6-28-10/h4-5,7,10,24H,2-3,6,8H2,1H3,(H2,19,25)(H,21,26) |
| InChIKey | LNFQBGFQIMAQRA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |