C17H15F2N3O2 — CID 45109562
N-[(E)-(2,6-difluorophenyl)methylideneamino]-3-(propanoylamino)benzamide (PubChem CID 45109562) has the molecular formula C17H15F2N3O2 and a molecular weight of 331.32 g/mol. Its IUPAC name is N-[(E)-(2,6-difluorophenyl)methylideneamino]-3-(propanoylamino)benzamide.
| Compound Name | N-[(E)-(2,6-difluorophenyl)methylideneamino]-3-(propanoylamino)benzamide |
|---|---|
| PubChem CID | 45109562 |
| Molecular Formula | C17H15F2N3O2 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-[(E)-(2,6-difluorophenyl)methylideneamino]-3-(propanoylamino)benzamide |
| SMILES | CCC(=O)Nc1cccc(C(=O)N/N=C/c2c(F)cccc2F)c1 |
| InChI | InChI=1S/C17H15F2N3O2/c1-2-16(23)21-12-6-3-5-11(9-12)17(24)22-20-10-13-14(18)7-4-8-15(13)19/h3-10H,2H2,1H3,(H,21,23)(H,22,24)/b20-10+ |
| InChIKey | QPMDIIPMODJBTA-KEBDBYFISA-N |
| XLogP | 3.08 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|