C22H27N3O2S — CID 45109011
3-(heptanoylamino)-N-[(E)-(4-methylsulfanylphenyl)methylideneamino]benzamide (PubChem CID 45109011) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is 3-(heptanoylamino)-N-[(E)-(4-methylsulfanylphenyl)methylideneamino]benzamide.
| Compound Name | 3-(heptanoylamino)-N-[(E)-(4-methylsulfanylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 45109011 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 3-(heptanoylamino)-N-[(E)-(4-methylsulfanylphenyl)methylideneamino]benzamide |
| SMILES | CCCCCCC(=O)Nc1cccc(C(=O)N/N=C/c2ccc(SC)cc2)c1 |
| InChI | InChI=1S/C22H27N3O2S/c1-3-4-5-6-10-21(26)24-19-9-7-8-18(15-19)22(27)25-23-16-17-11-13-20(28-2)14-12-17/h7-9,11-16H,3-6,10H2,1-2H3,(H,24,26)(H,25,27)/b23-16+ |
| InChIKey | WPQWVWDVPNWKKB-XQNSMLJCSA-N |
| XLogP | 5.08 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|