C24H29N3O5 — CID 6733357
[4-[[[3-(heptanoylamino)benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] acetate (PubChem CID 6733357) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is [4-[[[3-(heptanoylamino)benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[[[3-(heptanoylamino)benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 6733357 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | [4-[[[3-(heptanoylamino)benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] acetate |
| SMILES | CCCCCCC(=O)Nc1cccc(C(=O)NN=Cc2ccc(OC(C)=O)c(OC)c2)c1 |
| InChI | InChI=1S/C24H29N3O5/c1-4-5-6-7-11-23(29)26-20-10-8-9-19(15-20)24(30)27-25-16-18-12-13-21(32-17(2)28)22(14-18)31-3/h8-10,12-16H,4-7,11H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | OOTUSOHMVAQXNX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|