C22H25N3O4 — CID 45109635
N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(heptanoylamino)benzamide (PubChem CID 45109635) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(heptanoylamino)benzamide.
| Compound Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(heptanoylamino)benzamide |
|---|---|
| PubChem CID | 45109635 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(heptanoylamino)benzamide |
| SMILES | CCCCCCC(=O)Nc1cccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C22H25N3O4/c1-2-3-4-5-9-21(26)24-18-8-6-7-17(13-18)22(27)25-23-14-16-10-11-19-20(12-16)29-15-28-19/h6-8,10-14H,2-5,9,15H2,1H3,(H,24,26)(H,25,27)/b23-14+ |
| InChIKey | AIVLXNYYVMLRGF-OEAKJJBVSA-N |
| XLogP | 4.09 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|