C35H37N3O4 — CID 45109580
N-[(E)-[3,5-bis(phenylmethoxy)phenyl]methylideneamino]-3-(heptanoylamino)benzamide (PubChem CID 45109580) has the molecular formula C35H37N3O4 and a molecular weight of 563.70 g/mol. Its IUPAC name is N-[(E)-[3,5-bis(phenylmethoxy)phenyl]methylideneamino]-3-(heptanoylamino)benzamide.
| Compound Name | N-[(E)-[3,5-bis(phenylmethoxy)phenyl]methylideneamino]-3-(heptanoylamino)benzamide |
|---|---|
| PubChem CID | 45109580 |
| Molecular Formula | C35H37N3O4 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | N-[(E)-[3,5-bis(phenylmethoxy)phenyl]methylideneamino]-3-(heptanoylamino)benzamide |
| SMILES | CCCCCCC(=O)Nc1cccc(C(=O)N/N=C/c2cc(OCc3ccccc3)cc(OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C35H37N3O4/c1-2-3-4-11-19-34(39)37-31-18-12-17-30(22-31)35(40)38-36-24-29-20-32(41-25-27-13-7-5-8-14-27)23-33(21-29)42-26-28-15-9-6-10-16-28/h5-10,12-18,20-24H,2-4,11,19,25-26H2,1H3,(H,37,39)(H,38,40)/b36-24+ |
| InChIKey | SKNOHFDLTYTWCP-XBQJKBNESA-N |
| XLogP | 7.52 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|