C25H20ClIN6O2 — CID 45110054
N-[3-(4-chlorophenyl)-7-iodo-5-[(3-methoxyphenyl)methyl]-1,7-dihydropyrazolo[4,3-d]pyrimidin-6-yl]pyridine-3-carboxamide (PubChem CID 45110054) has the molecular formula C25H20ClIN6O2 and a molecular weight of 598.83 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)-7-iodo-5-[(3-methoxyphenyl)methyl]-1,7-dihydropyrazolo[4,3-d]pyrimidin-6-yl]pyridine-3-carboxamide.
| Compound Name | N-[3-(4-chlorophenyl)-7-iodo-5-[(3-methoxyphenyl)methyl]-1,7-dihydropyrazolo[4,3-d]pyrimidin-6-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 45110054 |
| Molecular Formula | C25H20ClIN6O2 |
| Molecular Weight | 598.83 g/mol |
| Exact Mass | 598.04 |
| IUPAC Name | N-[3-(4-chlorophenyl)-7-iodo-5-[(3-methoxyphenyl)methyl]-1,7-dihydropyrazolo[4,3-d]pyrimidin-6-yl]pyridine-3-carboxamide |
| SMILES | COc1cccc(CC2=Nc3c(-c4ccc(Cl)cc4)n[nH]c3C(I)N2NC(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C25H20ClIN6O2/c1-35-19-6-2-4-15(12-19)13-20-29-22-21(16-7-9-18(26)10-8-16)30-31-23(22)24(27)33(20)32-25(34)17-5-3-11-28-14-17/h2-12,14,24H,13H2,1H3,(H,30,31)(H,32,34) |
| InChIKey | GBBXQKOECQSBQE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.83 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|