C23H16ClIN6O — CID 45110812
N-[3-(2-chlorophenyl)-7-iodo-5-phenyl-1,7-dihydropyrazolo[4,3-d]pyrimidin-6-yl]pyridine-3-carboxamide (PubChem CID 45110812) has the molecular formula C23H16ClIN6O and a molecular weight of 554.78 g/mol. Its IUPAC name is N-[3-(2-chlorophenyl)-7-iodo-5-phenyl-1,7-dihydropyrazolo[4,3-d]pyrimidin-6-yl]pyridine-3-carboxamide.
| Compound Name | N-[3-(2-chlorophenyl)-7-iodo-5-phenyl-1,7-dihydropyrazolo[4,3-d]pyrimidin-6-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 45110812 |
| Molecular Formula | C23H16ClIN6O |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.01 |
| IUPAC Name | N-[3-(2-chlorophenyl)-7-iodo-5-phenyl-1,7-dihydropyrazolo[4,3-d]pyrimidin-6-yl]pyridine-3-carboxamide |
| SMILES | O=C(NN1C(c2ccccc2)=Nc2c(-c3ccccc3Cl)n[nH]c2C1I)c1cccnc1 |
| InChI | InChI=1S/C23H16ClIN6O/c24-17-11-5-4-10-16(17)18-19-20(29-28-18)21(25)31(22(27-19)14-7-2-1-3-8-14)30-23(32)15-9-6-12-26-13-15/h1-13,21H,(H,28,29)(H,30,32) |
| InChIKey | ITZHFNISJABMGK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|