C23H28F6N4O2 — CID 45111720
N-(2-butyl-5-tert-butyl-1-methylpyrazol-3-ylidene)-5-(trifluoromethyl)-2-[(E)-1,1,1-trifluoropropan-2-ylideneamino]oxybenzamide (PubChem CID 45111720) has the molecular formula C23H28F6N4O2 and a molecular weight of 506.49 g/mol. Its IUPAC name is N-(2-butyl-5-tert-butyl-1-methylpyrazol-3-ylidene)-5-(trifluoromethyl)-2-[(E)-1,1,1-trifluoropropan-2-ylideneamino]oxybenzamide.
| Compound Name | N-(2-butyl-5-tert-butyl-1-methylpyrazol-3-ylidene)-5-(trifluoromethyl)-2-[(E)-1,1,1-trifluoropropan-2-ylideneamino]oxybenzamide |
|---|---|
| PubChem CID | 45111720 |
| Molecular Formula | C23H28F6N4O2 |
| Molecular Weight | 506.49 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | N-(2-butyl-5-tert-butyl-1-methylpyrazol-3-ylidene)-5-(trifluoromethyl)-2-[(E)-1,1,1-trifluoropropan-2-ylideneamino]oxybenzamide |
| SMILES | CCCCn1/c(=N\C(=O)c2cc(C(F)(F)F)ccc2O/N=C(\C)C(F)(F)F)cc(C(C)(C)C)n1C |
| InChI | InChI=1S/C23H28F6N4O2/c1-7-8-11-33-19(13-18(32(33)6)21(3,4)5)30-20(34)16-12-15(23(27,28)29)9-10-17(16)35-31-14(2)22(24,25)26/h9-10,12-13H,7-8,11H2,1-6H3/b30-19-,31-14+ |
| InChIKey | QSHKMOBEWQMOCQ-XXJFHKQUSA-N |
| XLogP | 6.00 |
| TPSA | 60.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|