C21H24F6N4O2S — CID 75093111
N-(3-butyl-5-tert-butyl-1,3,4-thiadiazol-2-ylidene)-5-(trifluoromethyl)-2-(1,1,1-trifluoropropan-2-ylideneamino)oxybenzamide (PubChem CID 75093111) has the molecular formula C21H24F6N4O2S and a molecular weight of 510.50 g/mol. Its IUPAC name is N-(3-butyl-5-tert-butyl-1,3,4-thiadiazol-2-ylidene)-5-(trifluoromethyl)-2-(1,1,1-trifluoropropan-2-ylideneamino)oxybenzamide.
| Compound Name | N-(3-butyl-5-tert-butyl-1,3,4-thiadiazol-2-ylidene)-5-(trifluoromethyl)-2-(1,1,1-trifluoropropan-2-ylideneamino)oxybenzamide |
|---|---|
| PubChem CID | 75093111 |
| Molecular Formula | C21H24F6N4O2S |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | N-(3-butyl-5-tert-butyl-1,3,4-thiadiazol-2-ylidene)-5-(trifluoromethyl)-2-(1,1,1-trifluoropropan-2-ylideneamino)oxybenzamide |
| SMILES | CCCCn1nc(C(C)(C)C)s/c1=N/C(=O)c1cc(C(F)(F)F)ccc1ON=C(C)C(F)(F)F |
| InChI | InChI=1S/C21H24F6N4O2S/c1-6-7-10-31-18(34-17(29-31)19(3,4)5)28-16(32)14-11-13(21(25,26)27)8-9-15(14)33-30-12(2)20(22,23)24/h8-9,11H,6-7,10H2,1-5H3/b28-18+,30-12? |
| InChIKey | HJKIHRHBXOGICX-UKGCLRJSSA-N |
| XLogP | 6.12 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|