C32H35F3N3O5S+ — CID 53241823
[4-[[3-butyl-2-[2-[(2S)-2-hydroxypropoxy]-5-(trifluoromethyl)benzoyl]imino-[1,3]thiazolo[4,5-c]pyridin-5-ium-5-yl]methyl]-2,6-dimethylphenyl] acetate (PubChem CID 53241823) has the molecular formula C32H35F3N3O5S+ and a molecular weight of 630.71 g/mol. Its IUPAC name is [4-[[3-butyl-2-[2-[(2S)-2-hydroxypropoxy]-5-(trifluoromethyl)benzoyl]imino-[1,3]thiazolo[4,5-c]pyridin-5-ium-5-yl]methyl]-2,6-dimethylphenyl] acetate.
| Compound Name | [4-[[3-butyl-2-[2-[(2S)-2-hydroxypropoxy]-5-(trifluoromethyl)benzoyl]imino-[1,3]thiazolo[4,5-c]pyridin-5-ium-5-yl]methyl]-2,6-dimethylphenyl] acetate |
|---|---|
| PubChem CID | 53241823 |
| Molecular Formula | C32H35F3N3O5S+ |
| Molecular Weight | 630.71 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | [4-[[3-butyl-2-[2-[(2S)-2-hydroxypropoxy]-5-(trifluoromethyl)benzoyl]imino-[1,3]thiazolo[4,5-c]pyridin-5-ium-5-yl]methyl]-2,6-dimethylphenyl] acetate |
| SMILES | CCCCn1/c(=N/C(=O)c2cc(C(F)(F)F)ccc2OC[C@H](C)O)sc2cc[n+](Cc3cc(C)c(OC(C)=O)c(C)c3)cc21 |
| InChI | InChI=1S/C32H35F3N3O5S/c1-6-7-11-38-26-17-37(16-23-13-19(2)29(20(3)14-23)43-22(5)40)12-10-28(26)44-31(38)36-30(41)25-15-24(32(33,34)35)8-9-27(25)42-18-21(4)39/h8-10,12-15,17,21,39H,6-7,11,16,18H2,1-5H3/q+1/b36-31-/t21-/m0/s1 |
| InChIKey | XPQIDENSMWQBBV-SIWSJRHVSA-N |
| XLogP | 5.90 |
| TPSA | 94.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.71 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|